C15H25N3O7 — CID 143381173
4-nitrooxybutyl 4-amino-2-[[(Z)-hept-5-enoyl]amino]-4-oxobutanoate (PubChem CID 143381173) has the molecular formula C15H25N3O7 and a molecular weight of 359.38 g/mol. Its IUPAC name is 4-nitrooxybutyl 4-amino-2-[[(Z)-hept-5-enoyl]amino]-4-oxobutanoate.
| Compound Name | 4-nitrooxybutyl 4-amino-2-[[(Z)-hept-5-enoyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 143381173 |
| Molecular Formula | C15H25N3O7 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 4-nitrooxybutyl 4-amino-2-[[(Z)-hept-5-enoyl]amino]-4-oxobutanoate |
| SMILES | C/C=C\CCCC(=O)NC(CC(N)=O)C(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C15H25N3O7/c1-2-3-4-5-8-14(20)17-12(11-13(16)19)15(21)24-9-6-7-10-25-18(22)23/h2-3,12H,4-11H2,1H3,(H2,16,19)(H,17,20)/b3-2- |
| InChIKey | FPWNAPUFDVPDNU-IHWYPQMZSA-N |
| XLogP | 0.62 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|