About 6-nitrooxyhexyl (Z)-oct-5-enoate
6-nitrooxyhexyl (Z)-oct-5-enoate (PubChem CID 146553235) has the molecular formula C14H25NO5
and a molecular weight of 287.36 g/mol. Its IUPAC name is 6-nitrooxyhexyl (Z)-oct-5-enoate.
Molecular Properties
| Compound Name | 6-nitrooxyhexyl (Z)-oct-5-enoate |
| PubChem CID | 146553235 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 6-nitrooxyhexyl (Z)-oct-5-enoate |
| SMILES | CC/C=C\CCCC(=O)OCCCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C14H25NO5/c1-2-3-4-5-8-11-14(16)19-12-9-6-7-10-13-20-15(17)18/h3-4H,2,5-13H2,1H3/b4-3- |
| InChIKey | JYVLEDYXVXSSSG-ARJAWSKDSA-N |
| XLogP | 3.43 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitrooxyhexyl (Z)-oct-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitrooxyhexyl (Z)-oct-5-enoate?
The IUPAC name of 6-nitrooxyhexyl (Z)-oct-5-enoate (CID 146553235) is 6-nitrooxyhexyl (Z)-oct-5-enoate.
What is the SMILES notation for 6-nitrooxyhexyl (Z)-oct-5-enoate?
The canonical SMILES for 6-nitrooxyhexyl (Z)-oct-5-enoate is CC/C=C\CCCC(=O)OCCCCCCO[N+](=O)[O-].
What is the InChIKey of 6-nitrooxyhexyl (Z)-oct-5-enoate?
The InChIKey is JYVLEDYXVXSSSG-ARJAWSKDSA-N. The full InChI is InChI=1S/C14H25NO5/c1-2-3-4-5-8-11-14(16)19-12-9-6-7-10-13-20-15(17)18/h3-4H,2,5-13H2,1H3/b4-3-.
What are the key properties of 6-nitrooxyhexyl (Z)-oct-5-enoate?
6-nitrooxyhexyl (Z)-oct-5-enoate has a molecular weight of 287.36 g/mol, XLogP of 3.43, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitrooxyhexyl (Z)-oct-5-enoate is sourced from PubChem (CID 146553235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).