C34H58N4O4 — CID 143381317
5-cyclohexylpentylbenzene;3-[4-[3-[[(Z)-hept-5-enoyl]amino]propyl]piperazin-1-yl]propyl nitrate (PubChem CID 143381317) has the molecular formula C34H58N4O4 and a molecular weight of 586.86 g/mol. Its IUPAC name is 5-cyclohexylpentylbenzene;3-[4-[3-[[(Z)-hept-5-enoyl]amino]propyl]piperazin-1-yl]propyl nitrate.
| Compound Name | 5-cyclohexylpentylbenzene;3-[4-[3-[[(Z)-hept-5-enoyl]amino]propyl]piperazin-1-yl]propyl nitrate |
|---|---|
| PubChem CID | 143381317 |
| Molecular Formula | C34H58N4O4 |
| Molecular Weight | 586.86 g/mol |
| Exact Mass | 586.45 |
| IUPAC Name | 5-cyclohexylpentylbenzene;3-[4-[3-[[(Z)-hept-5-enoyl]amino]propyl]piperazin-1-yl]propyl nitrate |
| SMILES | C/C=C\CCCC(=O)NCCCN1CCN(CCCO[N+](=O)[O-])CC1.c1ccc(CCCCCC2CCCCC2)cc1 |
| InChI | InChI=1S/C17H32N4O4.C17H26/c1-2-3-4-5-8-17(22)18-9-6-10-19-12-14-20(15-13-19)11-7-16-25-21(23)24;1-4-10-16(11-5-1)14-8-3-9-15-17-12-6-2-7-13-17/h2-3H,4-16H2,1H3,(H,18,22);1,4-5,10-11,17H,2-3,6-9,12-15H2/b3-2-; |
| InChIKey | IYBGBZJHPWIJAF-OLGQORCHSA-N |
| XLogP | 6.82 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.86 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|