C31H57N3O6 — CID 143078597
1-cyclopentyldecan-3-one;2-[4-(3-nitrooxypropyl)piperazin-1-yl]ethyl (Z)-hept-5-enoate (PubChem CID 143078597) has the molecular formula C31H57N3O6 and a molecular weight of 567.81 g/mol. Its IUPAC name is 1-cyclopentyldecan-3-one;2-[4-(3-nitrooxypropyl)piperazin-1-yl]ethyl (Z)-hept-5-enoate.
| Compound Name | 1-cyclopentyldecan-3-one;2-[4-(3-nitrooxypropyl)piperazin-1-yl]ethyl (Z)-hept-5-enoate |
|---|---|
| PubChem CID | 143078597 |
| Molecular Formula | C31H57N3O6 |
| Molecular Weight | 567.81 g/mol |
| Exact Mass | 567.42 |
| IUPAC Name | 1-cyclopentyldecan-3-one;2-[4-(3-nitrooxypropyl)piperazin-1-yl]ethyl (Z)-hept-5-enoate |
| SMILES | C/C=C\CCCC(=O)OCCN1CCN(CCCO[N+](=O)[O-])CC1.CCCCCCCC(=O)CCC1CCCC1 |
| InChI | InChI=1S/C16H29N3O5.C15H28O/c1-2-3-4-5-7-16(20)23-15-13-18-11-9-17(10-12-18)8-6-14-24-19(21)22;1-2-3-4-5-6-11-15(16)13-12-14-9-7-8-10-14/h2-3H,4-15H2,1H3;14H,2-13H2,1H3/b3-2-; |
| InChIKey | UYDVVBGHJJAYFK-OLGQORCHSA-N |
| XLogP | 6.38 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.81 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|