C29H54N2O8 — CID 143380913
1-cyclopentyldecan-3-one;methanol;1-nitrooxypropan-2-yl 2-[[(Z)-hept-5-enoyl]amino]propanoate (PubChem CID 143380913) has the molecular formula C29H54N2O8 and a molecular weight of 558.76 g/mol. Its IUPAC name is 1-cyclopentyldecan-3-one;methanol;1-nitrooxypropan-2-yl 2-[[(Z)-hept-5-enoyl]amino]propanoate.
| Compound Name | 1-cyclopentyldecan-3-one;methanol;1-nitrooxypropan-2-yl 2-[[(Z)-hept-5-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 143380913 |
| Molecular Formula | C29H54N2O8 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.39 |
| IUPAC Name | 1-cyclopentyldecan-3-one;methanol;1-nitrooxypropan-2-yl 2-[[(Z)-hept-5-enoyl]amino]propanoate |
| SMILES | C/C=C\CCCC(=O)NC(C)C(=O)OC(C)CO[N+](=O)[O-].CCCCCCCC(=O)CCC1CCCC1.CO |
| InChI | InChI=1S/C15H28O.C13H22N2O6.CH4O/c1-2-3-4-5-6-11-15(16)13-12-14-9-7-8-10-14;1-4-5-6-7-8-12(16)14-11(3)13(17)21-10(2)9-20-15(18)19;1-2/h14H,2-13H2,1H3;4-5,10-11H,6-9H2,1-3H3,(H,14,16);2H,1H3/b;5-4-; |
| InChIKey | ANQQYWDOYOIAEK-FXHNQCOHSA-N |
| XLogP | 5.87 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|