C26H50O5 — CID 142233094
1-(3-hydroxycyclopentyl)decan-3-one;methanol;propan-2-yl (Z)-hept-5-enoate (PubChem CID 142233094) has the molecular formula C26H50O5 and a molecular weight of 442.68 g/mol. Its IUPAC name is 1-(3-hydroxycyclopentyl)decan-3-one;methanol;propan-2-yl (Z)-hept-5-enoate.
| Compound Name | 1-(3-hydroxycyclopentyl)decan-3-one;methanol;propan-2-yl (Z)-hept-5-enoate |
|---|---|
| PubChem CID | 142233094 |
| Molecular Formula | C26H50O5 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.37 |
| IUPAC Name | 1-(3-hydroxycyclopentyl)decan-3-one;methanol;propan-2-yl (Z)-hept-5-enoate |
| SMILES | C/C=C\CCCC(=O)OC(C)C.CCCCCCCC(=O)CCC1CCC(O)C1.CO |
| InChI | InChI=1S/C15H28O2.C10H18O2.CH4O/c1-2-3-4-5-6-7-14(16)10-8-13-9-11-15(17)12-13;1-4-5-6-7-8-10(11)12-9(2)3;1-2/h13,15,17H,2-12H2,1H3;4-5,9H,6-8H2,1-3H3;2H,1H3/b;5-4-; |
| InChIKey | CPTLFMAANFVWDV-FXHNQCOHSA-N |
| XLogP | 6.15 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|