C29H54O4 — CID 142057621
ethane;(3S)-2-methyl-3-(3-oxodecyl)cyclopentan-1-one;propan-2-yl oct-6-enoate (PubChem CID 142057621) has the molecular formula C29H54O4 and a molecular weight of 466.75 g/mol. Its IUPAC name is ethane;(3S)-2-methyl-3-(3-oxodecyl)cyclopentan-1-one;propan-2-yl oct-6-enoate.
| Compound Name | ethane;(3S)-2-methyl-3-(3-oxodecyl)cyclopentan-1-one;propan-2-yl oct-6-enoate |
|---|---|
| PubChem CID | 142057621 |
| Molecular Formula | C29H54O4 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.40 |
| IUPAC Name | ethane;(3S)-2-methyl-3-(3-oxodecyl)cyclopentan-1-one;propan-2-yl oct-6-enoate |
| SMILES | CC.CC=CCCCCC(=O)OC(C)C.CCCCCCCC(=O)CC[C@H]1CCC(=O)C1C |
| InChI | InChI=1S/C16H28O2.C11H20O2.C2H6/c1-3-4-5-6-7-8-15(17)11-9-14-10-12-16(18)13(14)2;1-4-5-6-7-8-9-11(12)13-10(2)3;1-2/h13-14H,3-12H2,1-2H3;4-5,10H,6-9H2,1-3H3;1-2H3/t13?,14-;;/m0../s1 |
| InChIKey | BOWMARQVAZBASY-HNYZGNTBSA-N |
| XLogP | 8.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|