C35H61N3O5 — CID 143078499
ethane;5-(2-methylcyclopentyl)pentylbenzene;2-[4-(3-nitrooxypropyl)piperazin-1-yl]ethyl (Z)-hept-5-enoate (PubChem CID 143078499) has the molecular formula C35H61N3O5 and a molecular weight of 603.89 g/mol. Its IUPAC name is ethane;5-(2-methylcyclopentyl)pentylbenzene;2-[4-(3-nitrooxypropyl)piperazin-1-yl]ethyl (Z)-hept-5-enoate.
| Compound Name | ethane;5-(2-methylcyclopentyl)pentylbenzene;2-[4-(3-nitrooxypropyl)piperazin-1-yl]ethyl (Z)-hept-5-enoate |
|---|---|
| PubChem CID | 143078499 |
| Molecular Formula | C35H61N3O5 |
| Molecular Weight | 603.89 g/mol |
| Exact Mass | 603.46 |
| IUPAC Name | ethane;5-(2-methylcyclopentyl)pentylbenzene;2-[4-(3-nitrooxypropyl)piperazin-1-yl]ethyl (Z)-hept-5-enoate |
| SMILES | C/C=C\CCCC(=O)OCCN1CCN(CCCO[N+](=O)[O-])CC1.CC.CC1CCCC1CCCCCc1ccccc1 |
| InChI | InChI=1S/C17H26.C16H29N3O5.C2H6/c1-15-9-8-14-17(15)13-7-3-6-12-16-10-4-2-5-11-16;1-2-3-4-5-7-16(20)23-15-13-18-11-9-17(10-12-18)8-6-14-24-19(21)22;1-2/h2,4-5,10-11,15,17H,3,6-9,12-14H2,1H3;2-3H,4-15H2,1H3;1-2H3/b;3-2-; |
| InChIKey | VGJBUJJFFCUZDK-PMOSZIESSA-N |
| XLogP | 7.74 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.89 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|