C32H44N2O6 — CID 143381220
5-cyclopentylpentylbenzene;[3-(nitrooxymethyl)phenyl] 2-[[(Z)-hept-5-enoyl]amino]acetate (PubChem CID 143381220) has the molecular formula C32H44N2O6 and a molecular weight of 552.71 g/mol. Its IUPAC name is 5-cyclopentylpentylbenzene;[3-(nitrooxymethyl)phenyl] 2-[[(Z)-hept-5-enoyl]amino]acetate.
| Compound Name | 5-cyclopentylpentylbenzene;[3-(nitrooxymethyl)phenyl] 2-[[(Z)-hept-5-enoyl]amino]acetate |
|---|---|
| PubChem CID | 143381220 |
| Molecular Formula | C32H44N2O6 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | 5-cyclopentylpentylbenzene;[3-(nitrooxymethyl)phenyl] 2-[[(Z)-hept-5-enoyl]amino]acetate |
| SMILES | C/C=C\CCCC(=O)NCC(=O)Oc1cccc(CO[N+](=O)[O-])c1.c1ccc(CCCCCC2CCCC2)cc1 |
| InChI | InChI=1S/C16H20N2O6.C16H24/c1-2-3-4-5-9-15(19)17-11-16(20)24-14-8-6-7-13(10-14)12-23-18(21)22;1-3-9-15(10-4-1)11-5-2-6-12-16-13-7-8-14-16/h2-3,6-8,10H,4-5,9,11-12H2,1H3,(H,17,19);1,3-4,9-10,16H,2,5-8,11-14H2/b3-2-; |
| InChIKey | XQTRMDXFJDWYJN-OLGQORCHSA-N |
| XLogP | 7.14 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|