C43H61NO4 — CID 142426735
[4,5-bis(hex-5-ynoxymethyl)-2-methyl-3-pyridinyl] (Z)-hept-5-enoate;5-cyclopentylpentylbenzene (PubChem CID 142426735) has the molecular formula C43H61NO4 and a molecular weight of 655.96 g/mol. Its IUPAC name is [4,5-bis(hex-5-ynoxymethyl)-2-methyl-3-pyridinyl] (Z)-hept-5-enoate;5-cyclopentylpentylbenzene.
| Compound Name | [4,5-bis(hex-5-ynoxymethyl)-2-methyl-3-pyridinyl] (Z)-hept-5-enoate;5-cyclopentylpentylbenzene |
|---|---|
| PubChem CID | 142426735 |
| Molecular Formula | C43H61NO4 |
| Molecular Weight | 655.96 g/mol |
| Exact Mass | 655.46 |
| IUPAC Name | [4,5-bis(hex-5-ynoxymethyl)-2-methyl-3-pyridinyl] (Z)-hept-5-enoate;5-cyclopentylpentylbenzene |
| SMILES | C#CCCCCOCc1cnc(C)c(OC(=O)CCC/C=C\C)c1COCCCCC#C.c1ccc(CCCCCC2CCCC2)cc1 |
| InChI | InChI=1S/C27H37NO4.C16H24/c1-5-8-11-14-17-26(29)32-27-23(4)28-20-24(21-30-18-15-12-9-6-2)25(27)22-31-19-16-13-10-7-3;1-3-9-15(10-4-1)11-5-2-6-12-16-13-7-8-14-16/h2-3,5,8,20H,9-19,21-22H2,1,4H3;1,3-4,9-10,16H,2,5-8,11-14H2/b8-5-; |
| InChIKey | GPSBZAVNHDSXAH-HGKIGUAWSA-N |
| XLogP | 10.66 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.96 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|