C45H59NO9 — CID 146535285
[4,5-bis(3,3-dimethylpent-4-ynoyloxymethyl)-2-methyl-3-pyridinyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate (PubChem CID 146535285) has the molecular formula C45H59NO9 and a molecular weight of 757.96 g/mol. Its IUPAC name is [4,5-bis(3,3-dimethylpent-4-ynoyloxymethyl)-2-methyl-3-pyridinyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate.
| Compound Name | [4,5-bis(3,3-dimethylpent-4-ynoyloxymethyl)-2-methyl-3-pyridinyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 146535285 |
| Molecular Formula | C45H59NO9 |
| Molecular Weight | 757.96 g/mol |
| Exact Mass | 757.42 |
| IUPAC Name | [4,5-bis(3,3-dimethylpent-4-ynoyloxymethyl)-2-methyl-3-pyridinyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
| SMILES | C#CC(C)(C)CC(=O)OCc1cnc(C)c(OC(=O)CCC/C=C\C[C@@H]2[C@@H](CC[C@@H](O)CCc3ccccc3)[C@H](O)C[C@@H]2O)c1COC(=O)CC(C)(C)C#C |
| InChI | InChI=1S/C45H59NO9/c1-8-44(4,5)26-41(51)53-29-33-28-46-31(3)43(37(33)30-54-42(52)27-45(6,7)9-2)55-40(50)20-16-11-10-15-19-35-36(39(49)25-38(35)48)24-23-34(47)22-21-32-17-13-12-14-18-32/h1-2,10,12-15,17-18,28,34-36,38-39,47-49H,11,16,19-27,29-30H2,3-7H3/b15-10-/t34-,35+,36+,38-,39+/m0/s1 |
| InChIKey | IFQUCZKYACJAPG-ANLJWSNKSA-N |
| XLogP | 6.73 |
| TPSA | 152.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.96 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|