C41H50O9 — CID 118634036
[3,5-di(hex-5-ynoyloxy)phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate (PubChem CID 118634036) has the molecular formula C41H50O9 and a molecular weight of 686.84 g/mol. Its IUPAC name is [3,5-di(hex-5-ynoyloxy)phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate.
| Compound Name | [3,5-di(hex-5-ynoyloxy)phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 118634036 |
| Molecular Formula | C41H50O9 |
| Molecular Weight | 686.84 g/mol |
| Exact Mass | 686.35 |
| IUPAC Name | [3,5-di(hex-5-ynoyloxy)phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
| SMILES | C#CCCCC(=O)Oc1cc(OC(=O)CCCC#C)cc(OC(=O)CCC/C=C\C[C@@H]2[C@@H](CC[C@@H](O)CCc3ccccc3)[C@H](O)C[C@@H]2O)c1 |
| InChI | InChI=1S/C41H50O9/c1-3-5-10-19-39(45)48-32-26-33(49-40(46)20-11-6-4-2)28-34(27-32)50-41(47)21-15-8-7-14-18-35-36(38(44)29-37(35)43)25-24-31(42)23-22-30-16-12-9-13-17-30/h1-2,7,9,12-14,16-17,26-28,31,35-38,42-44H,5-6,8,10-11,15,18-25,29H2/b14-7-/t31-,35+,36+,37-,38+/m0/s1 |
| InChIKey | YBPIJIZJXLLKQR-VHAIIOAQSA-N |
| XLogP | 6.26 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.84 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|