C37H50F2N2O9 — CID 143381542
[(E)-4-cyclopentyl-2,2-difluorobut-3-enoxy]benzene;[4-(2-methoxyethyl)phenyl] 2-[[(Z)-hept-5-enoyl]amino]acetate;4-oxobutyl nitrate (PubChem CID 143381542) has the molecular formula C37H50F2N2O9 and a molecular weight of 704.81 g/mol. Its IUPAC name is [(E)-4-cyclopentyl-2,2-difluorobut-3-enoxy]benzene;[4-(2-methoxyethyl)phenyl] 2-[[(Z)-hept-5-enoyl]amino]acetate;4-oxobutyl nitrate.
| Compound Name | [(E)-4-cyclopentyl-2,2-difluorobut-3-enoxy]benzene;[4-(2-methoxyethyl)phenyl] 2-[[(Z)-hept-5-enoyl]amino]acetate;4-oxobutyl nitrate |
|---|---|
| PubChem CID | 143381542 |
| Molecular Formula | C37H50F2N2O9 |
| Molecular Weight | 704.81 g/mol |
| Exact Mass | 704.35 |
| IUPAC Name | [(E)-4-cyclopentyl-2,2-difluorobut-3-enoxy]benzene;[4-(2-methoxyethyl)phenyl] 2-[[(Z)-hept-5-enoyl]amino]acetate;4-oxobutyl nitrate |
| SMILES | C/C=C\CCCC(=O)NCC(=O)Oc1ccc(CCOC)cc1.FC(F)(/C=C/C1CCCC1)COc1ccccc1.O=CCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C18H25NO4.C15H18F2O.C4H7NO4/c1-3-4-5-6-7-17(20)19-14-18(21)23-16-10-8-15(9-11-16)12-13-22-2;16-15(17,11-10-13-6-4-5-7-13)12-18-14-8-2-1-3-9-14;6-3-1-2-4-9-5(7)8/h3-4,8-11H,5-7,12-14H2,1-2H3,(H,19,20);1-3,8-11,13H,4-7,12H2;3H,1-2,4H2/b4-3-;11-10+; |
| InChIKey | XLSSSCBLDJXTKD-JUQILKSNSA-N |
| XLogP | 7.26 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.81 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|