C34H55F3N4O6 — CID 143381377
1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;3-[4-[3-[[(Z)-hept-5-enoyl]amino]propyl]piperazin-1-yl]propyl nitrate;methanol (PubChem CID 143381377) has the molecular formula C34H55F3N4O6 and a molecular weight of 672.83 g/mol. Its IUPAC name is 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;3-[4-[3-[[(Z)-hept-5-enoyl]amino]propyl]piperazin-1-yl]propyl nitrate;methanol.
| Compound Name | 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;3-[4-[3-[[(Z)-hept-5-enoyl]amino]propyl]piperazin-1-yl]propyl nitrate;methanol |
|---|---|
| PubChem CID | 143381377 |
| Molecular Formula | C34H55F3N4O6 |
| Molecular Weight | 672.83 g/mol |
| Exact Mass | 672.41 |
| IUPAC Name | 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;3-[4-[3-[[(Z)-hept-5-enoyl]amino]propyl]piperazin-1-yl]propyl nitrate;methanol |
| SMILES | C/C=C\CCCC(=O)NCCCN1CCN(CCCO[N+](=O)[O-])CC1.CO.FC(F)(F)c1cccc(OCC/C=C/C2CCCC2)c1 |
| InChI | InChI=1S/C17H32N4O4.C16H19F3O.CH4O/c1-2-3-4-5-8-17(22)18-9-6-10-19-12-14-20(15-13-19)11-7-16-25-21(23)24;17-16(18,19)14-9-5-10-15(12-14)20-11-4-3-8-13-6-1-2-7-13;1-2/h2-3H,4-16H2,1H3,(H,18,22);3,5,8-10,12-13H,1-2,4,6-7,11H2;2H,1H3/b3-2-;8-3+; |
| InChIKey | NGYNYNZRDNWXPJ-LGTLDFEESA-N |
| XLogP | 6.28 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.83 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|