C34H45F3N2O7 — CID 143381048
1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;(Z)-hept-5-enal;[3-(nitrooxymethyl)phenyl]methyl 2-(methylamino)acetate (PubChem CID 143381048) has the molecular formula C34H45F3N2O7 and a molecular weight of 650.74 g/mol. Its IUPAC name is 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;(Z)-hept-5-enal;[3-(nitrooxymethyl)phenyl]methyl 2-(methylamino)acetate.
| Compound Name | 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;(Z)-hept-5-enal;[3-(nitrooxymethyl)phenyl]methyl 2-(methylamino)acetate |
|---|---|
| PubChem CID | 143381048 |
| Molecular Formula | C34H45F3N2O7 |
| Molecular Weight | 650.74 g/mol |
| Exact Mass | 650.32 |
| IUPAC Name | 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;(Z)-hept-5-enal;[3-(nitrooxymethyl)phenyl]methyl 2-(methylamino)acetate |
| SMILES | C/C=C\CCCC=O.CNCC(=O)OCc1cccc(CO[N+](=O)[O-])c1.FC(F)(F)c1cccc(OCC/C=C/C2CCCC2)c1 |
| InChI | InChI=1S/C16H19F3O.C11H14N2O5.C7H12O/c17-16(18,19)14-9-5-10-15(12-14)20-11-4-3-8-13-6-1-2-7-13;1-12-6-11(14)17-7-9-3-2-4-10(5-9)8-18-13(15)16;1-2-3-4-5-6-7-8/h3,5,8-10,12-13H,1-2,4,6-7,11H2;2-5,12H,6-8H2,1H3;2-3,7H,4-6H2,1H3/b8-3+;;3-2- |
| InChIKey | HATRNMMZXGSNIM-SEZATHFVSA-N |
| XLogP | 7.81 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.74 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|