C33H45ClN2O7 — CID 143381061
1-chloro-3-[(E)-4-cyclopentylbut-3-enoxy]benzene;(Z)-hept-2-ene;[2-(nitrooxymethyl)phenyl]methyl 2-formamidoacetate (PubChem CID 143381061) has the molecular formula C33H45ClN2O7 and a molecular weight of 617.18 g/mol. Its IUPAC name is 1-chloro-3-[(E)-4-cyclopentylbut-3-enoxy]benzene;(Z)-hept-2-ene;[2-(nitrooxymethyl)phenyl]methyl 2-formamidoacetate.
| Compound Name | 1-chloro-3-[(E)-4-cyclopentylbut-3-enoxy]benzene;(Z)-hept-2-ene;[2-(nitrooxymethyl)phenyl]methyl 2-formamidoacetate |
|---|---|
| PubChem CID | 143381061 |
| Molecular Formula | C33H45ClN2O7 |
| Molecular Weight | 617.18 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | 1-chloro-3-[(E)-4-cyclopentylbut-3-enoxy]benzene;(Z)-hept-2-ene;[2-(nitrooxymethyl)phenyl]methyl 2-formamidoacetate |
| SMILES | C/C=C\CCCC.Clc1cccc(OCC/C=C/C2CCCC2)c1.O=CNCC(=O)OCc1ccccc1CO[N+](=O)[O-] |
| InChI | InChI=1S/C15H19ClO.C11H12N2O6.C7H14/c16-14-9-5-10-15(12-14)17-11-4-3-8-13-6-1-2-7-13;14-8-12-5-11(15)18-6-9-3-1-2-4-10(9)7-19-13(16)17;1-3-5-7-6-4-2/h3,5,8-10,12-13H,1-2,4,6-7,11H2;1-4,8H,5-7H2,(H,12,14);3,5H,4,6-7H2,1-2H3/b8-3+;;5-3- |
| InChIKey | LYISBMBADCDIAN-SZENVYGZSA-N |
| XLogP | 7.79 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.18 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|