C33H45F3N2O5 — CID 143380963
1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;[4-(formamidomethyl)phenyl]methyl nitrate;(Z)-oct-3-ene (PubChem CID 143380963) has the molecular formula C33H45F3N2O5 and a molecular weight of 606.73 g/mol. Its IUPAC name is 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;[4-(formamidomethyl)phenyl]methyl nitrate;(Z)-oct-3-ene.
| Compound Name | 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;[4-(formamidomethyl)phenyl]methyl nitrate;(Z)-oct-3-ene |
|---|---|
| PubChem CID | 143380963 |
| Molecular Formula | C33H45F3N2O5 |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.33 |
| IUPAC Name | 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;[4-(formamidomethyl)phenyl]methyl nitrate;(Z)-oct-3-ene |
| SMILES | CC/C=C\CCCC.FC(F)(F)c1cccc(OCC/C=C/C2CCCC2)c1.O=CNCc1ccc(CO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H19F3O.C9H10N2O4.C8H16/c17-16(18,19)14-9-5-10-15(12-14)20-11-4-3-8-13-6-1-2-7-13;12-7-10-5-8-1-3-9(4-2-8)6-15-11(13)14;1-3-5-7-8-6-4-2/h3,5,8-10,12-13H,1-2,4,6-7,11H2;1-4,7H,5-6H2,(H,10,12);5,7H,3-4,6,8H2,1-2H3/b8-3+;;7-5- |
| InChIKey | FQELYZYFFUZRRJ-SIHAREEVSA-N |
| XLogP | 9.00 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|