C27H38F3NO7 — CID 143078704
(E)-4-cyclopentyl-1-[3-(trifluoromethyl)phenoxy]but-3-en-2-ol;2-nitrooxypropyl oct-5-enoate (PubChem CID 143078704) has the molecular formula C27H38F3NO7 and a molecular weight of 545.60 g/mol. Its IUPAC name is (E)-4-cyclopentyl-1-[3-(trifluoromethyl)phenoxy]but-3-en-2-ol;2-nitrooxypropyl oct-5-enoate.
| Compound Name | (E)-4-cyclopentyl-1-[3-(trifluoromethyl)phenoxy]but-3-en-2-ol;2-nitrooxypropyl oct-5-enoate |
|---|---|
| PubChem CID | 143078704 |
| Molecular Formula | C27H38F3NO7 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | (E)-4-cyclopentyl-1-[3-(trifluoromethyl)phenoxy]but-3-en-2-ol;2-nitrooxypropyl oct-5-enoate |
| SMILES | CCC=CCCCC(=O)OCC(C)O[N+](=O)[O-].OC(/C=C/C1CCCC1)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F3O2.C11H19NO5/c17-16(18,19)13-6-3-7-15(10-13)21-11-14(20)9-8-12-4-1-2-5-12;1-3-4-5-6-7-8-11(13)16-9-10(2)17-12(14)15/h3,6-10,12,14,20H,1-2,4-5,11H2;4-5,10H,3,6-9H2,1-2H3/b9-8+; |
| InChIKey | MQULNDBOWPJZNW-HRNDJLQDSA-N |
| XLogP | 6.45 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|