C29H41F3N2O7 — CID 143381156
1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;3-nitrooxypropyl 2-[[(Z)-hept-5-enoyl]amino]propanoate (PubChem CID 143381156) has the molecular formula C29H41F3N2O7 and a molecular weight of 586.65 g/mol. Its IUPAC name is 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;3-nitrooxypropyl 2-[[(Z)-hept-5-enoyl]amino]propanoate.
| Compound Name | 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;3-nitrooxypropyl 2-[[(Z)-hept-5-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 143381156 |
| Molecular Formula | C29H41F3N2O7 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;3-nitrooxypropyl 2-[[(Z)-hept-5-enoyl]amino]propanoate |
| SMILES | C/C=C\CCCC(=O)NC(C)C(=O)OCCCO[N+](=O)[O-].FC(F)(F)c1cccc(OCC/C=C/C2CCCC2)c1 |
| InChI | InChI=1S/C16H19F3O.C13H22N2O6/c17-16(18,19)14-9-5-10-15(12-14)20-11-4-3-8-13-6-1-2-7-13;1-3-4-5-6-8-12(16)14-11(2)13(17)20-9-7-10-21-15(18)19/h3,5,8-10,12-13H,1-2,4,6-7,11H2;3-4,11H,5-10H2,1-2H3,(H,14,16)/b8-3+;4-3- |
| InChIKey | ZYOMXGWLJZSZTC-QERRIZJRSA-N |
| XLogP | 6.60 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|