C27H42N2O7 — CID 15942121
4-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoyl]amino]butyl nitrate (PubChem CID 15942121) has the molecular formula C27H42N2O7 and a molecular weight of 506.64 g/mol. Its IUPAC name is 4-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoyl]amino]butyl nitrate.
| Compound Name | 4-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoyl]amino]butyl nitrate |
|---|---|
| PubChem CID | 15942121 |
| Molecular Formula | C27H42N2O7 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | 4-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoyl]amino]butyl nitrate |
| SMILES | O=C(CCC/C=C\C[C@@H]1[C@@H](CC[C@@H](O)CCc2ccccc2)[C@H](O)C[C@@H]1O)NCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C27H42N2O7/c30-22(15-14-21-10-4-3-5-11-21)16-17-24-23(25(31)20-26(24)32)12-6-1-2-7-13-27(33)28-18-8-9-19-36-29(34)35/h1,3-6,10-11,22-26,30-32H,2,7-9,12-20H2,(H,28,33)/b6-1-/t22-,23+,24+,25-,26+/m0/s1 |
| InChIKey | WFDCRVYOVXLLCY-UIEAZXIASA-N |
| XLogP | 3.34 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|