C26H40N2O7 — CID 90817304
1-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoylamino]propan-2-yl nitrate (PubChem CID 90817304) has the molecular formula C26H40N2O7 and a molecular weight of 492.61 g/mol. Its IUPAC name is 1-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoylamino]propan-2-yl nitrate.
| Compound Name | 1-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoylamino]propan-2-yl nitrate |
|---|---|
| PubChem CID | 90817304 |
| Molecular Formula | C26H40N2O7 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | 1-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoylamino]propan-2-yl nitrate |
| SMILES | CC(CNC(=O)CCCC=CC[C@@H]1[C@@H](CC[C@@H](O)CCc2ccccc2)[C@H](O)C[C@@H]1O)O[N+](=O)[O-] |
| InChI | InChI=1S/C26H40N2O7/c1-19(35-28(33)34)18-27-26(32)12-8-3-2-7-11-22-23(25(31)17-24(22)30)16-15-21(29)14-13-20-9-5-4-6-10-20/h2,4-7,9-10,19,21-25,29-31H,3,8,11-18H2,1H3,(H,27,32)/t19?,21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | POEQHEDCGOQCJU-WSYLJFEMSA-N |
| XLogP | 2.95 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|