C34H47NO6 — CID 70888587
(2-methylphenyl)methyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoyl]amino]propanoate (PubChem CID 70888587) has the molecular formula C34H47NO6 and a molecular weight of 565.75 g/mol. Its IUPAC name is (2-methylphenyl)methyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoyl]amino]propanoate.
| Compound Name | (2-methylphenyl)methyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 70888587 |
| Molecular Formula | C34H47NO6 |
| Molecular Weight | 565.75 g/mol |
| Exact Mass | 565.34 |
| IUPAC Name | (2-methylphenyl)methyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoyl]amino]propanoate |
| SMILES | Cc1ccccc1COC(=O)C(C)NC(=O)CCC/C=C\C[C@@H]1[C@@H](CC[C@@H](O)CCc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C34H47NO6/c1-24-12-10-11-15-27(24)23-41-34(40)25(2)35-33(39)17-9-4-3-8-16-29-30(32(38)22-31(29)37)21-20-28(36)19-18-26-13-6-5-7-14-26/h3,5-8,10-15,25,28-32,36-38H,4,9,16-23H2,1-2H3,(H,35,39)/b8-3-/t25?,28-,29+,30+,31-,32+/m0/s1 |
| InChIKey | AAPBLDVZXSGESV-GOEYYMFKSA-N |
| XLogP | 4.79 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.75 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|