C29H44N2O9 — CID 90769406
1-nitrooxypropan-2-yl 2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoylamino]propanoate (PubChem CID 90769406) has the molecular formula C29H44N2O9 and a molecular weight of 564.68 g/mol. Its IUPAC name is 1-nitrooxypropan-2-yl 2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoylamino]propanoate.
| Compound Name | 1-nitrooxypropan-2-yl 2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoylamino]propanoate |
|---|---|
| PubChem CID | 90769406 |
| Molecular Formula | C29H44N2O9 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | 1-nitrooxypropan-2-yl 2-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoylamino]propanoate |
| SMILES | CC(CO[N+](=O)[O-])OC(=O)C(C)NC(=O)CCCC=CC[C@@H]1[C@@H](CC[C@@H](O)CCc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C29H44N2O9/c1-20(19-39-31(37)38)40-29(36)21(2)30-28(35)13-9-4-3-8-12-24-25(27(34)18-26(24)33)17-16-23(32)15-14-22-10-6-5-7-11-22/h3,5-8,10-11,20-21,23-27,32-34H,4,9,12-19H2,1-2H3,(H,30,35)/t20?,21?,23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | YWGFDUSIAMRWBN-FNMRFSTPSA-N |
| XLogP | 2.88 |
| TPSA | 168.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|