C34H51F3N2O9 — CID 11158237
3-[4-(3-nitrooxypropyl)piperidin-1-yl]propyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]butyl]cyclopentyl]hept-5-enoate (PubChem CID 11158237) has the molecular formula C34H51F3N2O9 and a molecular weight of 688.78 g/mol. Its IUPAC name is 3-[4-(3-nitrooxypropyl)piperidin-1-yl]propyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]butyl]cyclopentyl]hept-5-enoate.
| Compound Name | 3-[4-(3-nitrooxypropyl)piperidin-1-yl]propyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]butyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 11158237 |
| Molecular Formula | C34H51F3N2O9 |
| Molecular Weight | 688.78 g/mol |
| Exact Mass | 688.35 |
| IUPAC Name | 3-[4-(3-nitrooxypropyl)piperidin-1-yl]propyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]butyl]cyclopentyl]hept-5-enoate |
| SMILES | O=C(CCC/C=C\C[C@@H]1[C@@H](CC[C@@H](O)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O)OCCCN1CCC(CCCO[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C34H51F3N2O9/c35-34(36,37)26-9-5-10-28(22-26)47-24-27(40)13-14-30-29(31(41)23-32(30)42)11-3-1-2-4-12-33(43)46-20-7-17-38-18-15-25(16-19-38)8-6-21-48-39(44)45/h1,3,5,9-10,22,25,27,29-32,40-42H,2,4,6-8,11-21,23-24H2/b3-1-/t27-,29-,30-,31+,32-/m1/s1 |
| InChIKey | SVRCJXPIYKFPOO-LCWWCELTSA-N |
| XLogP | 5.33 |
| TPSA | 151.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.78 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|