C18H25ClO5 — CID 167222943
(3aR,4R,5R,6aS)-4-[(3R)-4-(3-chlorophenoxy)-3-hydroxybutyl]-2-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol (PubChem CID 167222943) has the molecular formula C18H25ClO5 and a molecular weight of 356.85 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(3R)-4-(3-chlorophenoxy)-3-hydroxybutyl]-2-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol.
| Compound Name | (3aR,4R,5R,6aS)-4-[(3R)-4-(3-chlorophenoxy)-3-hydroxybutyl]-2-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol |
|---|---|
| PubChem CID | 167222943 |
| Molecular Formula | C18H25ClO5 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(3R)-4-(3-chlorophenoxy)-3-hydroxybutyl]-2-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol |
| SMILES | OCC1C[C@@H]2[C@@H](CC[C@@H](O)COc3cccc(Cl)c3)[C@H](O)C[C@@H]2O1 |
| InChI | InChI=1S/C18H25ClO5/c19-11-2-1-3-13(6-11)23-10-12(21)4-5-15-16-7-14(9-20)24-18(16)8-17(15)22/h1-3,6,12,14-18,20-22H,4-5,7-10H2/t12-,14?,15-,16-,17-,18+/m1/s1 |
| InChIKey | UGXKWTYERYSPTG-QDEVPMMISA-N |
| XLogP | 2.01 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |