C17H22ClNO4 — CID 59951940
(3aR,4R,6aR)-4-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-5-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-ol (PubChem CID 59951940) has the molecular formula C17H22ClNO4 and a molecular weight of 339.82 g/mol. Its IUPAC name is (3aR,4R,6aR)-4-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-5-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-ol.
| Compound Name | (3aR,4R,6aR)-4-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-5-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-ol |
|---|---|
| PubChem CID | 59951940 |
| Molecular Formula | C17H22ClNO4 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (3aR,4R,6aR)-4-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-5-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-ol |
| SMILES | CN1C[C@@H]2OC(O)C[C@@H]2[C@H]1/C=C/[C@@H](O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H22ClNO4/c1-19-9-16-14(8-17(21)23-16)15(19)6-5-12(20)10-22-13-4-2-3-11(18)7-13/h2-7,12,14-17,20-21H,8-10H2,1H3/b6-5+/t12-,14-,15-,16+,17?/m1/s1 |
| InChIKey | HRSIYKOFDDLQQJ-RAWSTTNBSA-N |
| XLogP | 1.67 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|