C16H25ClO2Si — CID 139710033
(E)-4-[tert-butyl(dimethyl)silyl]-1-(3-chlorophenoxy)but-3-en-2-ol (PubChem CID 139710033) has the molecular formula C16H25ClO2Si and a molecular weight of 312.91 g/mol. Its IUPAC name is (E)-4-[tert-butyl(dimethyl)silyl]-1-(3-chlorophenoxy)but-3-en-2-ol.
| Compound Name | (E)-4-[tert-butyl(dimethyl)silyl]-1-(3-chlorophenoxy)but-3-en-2-ol |
|---|---|
| PubChem CID | 139710033 |
| Molecular Formula | C16H25ClO2Si |
| Molecular Weight | 312.91 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (E)-4-[tert-butyl(dimethyl)silyl]-1-(3-chlorophenoxy)but-3-en-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)/C=C/C(O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H25ClO2Si/c1-16(2,3)20(4,5)10-9-14(18)12-19-15-8-6-7-13(17)11-15/h6-11,14,18H,12H2,1-5H3/b10-9+ |
| InChIKey | NRRBZGOEANCABW-MDZDMXLPSA-N |
| XLogP | 4.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.91 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|