C15H22ClNO3 — CID 63712910
1-(3-chlorophenoxy)-3-(oxan-4-ylmethylamino)propan-2-ol (PubChem CID 63712910) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is 1-(3-chlorophenoxy)-3-(oxan-4-ylmethylamino)propan-2-ol.
| Compound Name | 1-(3-chlorophenoxy)-3-(oxan-4-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 63712910 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-(3-chlorophenoxy)-3-(oxan-4-ylmethylamino)propan-2-ol |
| SMILES | OC(CNCC1CCOCC1)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H22ClNO3/c16-13-2-1-3-15(8-13)20-11-14(18)10-17-9-12-4-6-19-7-5-12/h1-3,8,12,14,17-18H,4-7,9-11H2 |
| InChIKey | TXBAMJHKJTUGAA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |