C16H22N2O3 — CID 63711326
3-[2-hydroxy-3-(oxan-4-ylmethylamino)propoxy]benzonitrile (PubChem CID 63711326) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(oxan-4-ylmethylamino)propoxy]benzonitrile.
| Compound Name | 3-[2-hydroxy-3-(oxan-4-ylmethylamino)propoxy]benzonitrile |
|---|---|
| PubChem CID | 63711326 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 3-[2-hydroxy-3-(oxan-4-ylmethylamino)propoxy]benzonitrile |
| SMILES | N#Cc1cccc(OCC(O)CNCC2CCOCC2)c1 |
| InChI | InChI=1S/C16H22N2O3/c17-9-14-2-1-3-16(8-14)21-12-15(19)11-18-10-13-4-6-20-7-5-13/h1-3,8,13,15,18-19H,4-7,10-12H2 |
| InChIKey | RPTYETYSTYSRDB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 74.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |