C21H27FO5S — CID 57010404
7-[2-[3-(4-fluorophenoxy)-2-hydroxypropyl]sulfanyl-5-oxocyclopent-3-en-1-yl]heptanoic acid (PubChem CID 57010404) has the molecular formula C21H27FO5S and a molecular weight of 410.51 g/mol. Its IUPAC name is 7-[2-[3-(4-fluorophenoxy)-2-hydroxypropyl]sulfanyl-5-oxocyclopent-3-en-1-yl]heptanoic acid.
| Compound Name | 7-[2-[3-(4-fluorophenoxy)-2-hydroxypropyl]sulfanyl-5-oxocyclopent-3-en-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 57010404 |
| Molecular Formula | C21H27FO5S |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 7-[2-[3-(4-fluorophenoxy)-2-hydroxypropyl]sulfanyl-5-oxocyclopent-3-en-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(=O)C=CC1SCC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C21H27FO5S/c22-15-7-9-17(10-8-15)27-13-16(23)14-28-20-12-11-19(24)18(20)5-3-1-2-4-6-21(25)26/h7-12,16,18,20,23H,1-6,13-14H2,(H,25,26) |
| InChIKey | BCACAUIYJNUHTQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|