C10H11FO4 — CID 22564574
4-(4-fluorophenoxy)-3-hydroxybutanoic acid (PubChem CID 22564574) has the molecular formula C10H11FO4 and a molecular weight of 214.19 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-3-hydroxybutanoic acid.
| Compound Name | 4-(4-fluorophenoxy)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 22564574 |
| Molecular Formula | C10H11FO4 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 4-(4-fluorophenoxy)-3-hydroxybutanoic acid |
| SMILES | O=C(O)CC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C10H11FO4/c11-7-1-3-9(4-2-7)15-6-8(12)5-10(13)14/h1-4,8,12H,5-6H2,(H,13,14) |
| InChIKey | OWADQJOMSJFOMT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |