C13H19FN2O3 — CID 61464487
2-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]-N-methylpropanamide (PubChem CID 61464487) has the molecular formula C13H19FN2O3 and a molecular weight of 270.30 g/mol. Its IUPAC name is 2-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]-N-methylpropanamide.
| Compound Name | 2-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 61464487 |
| Molecular Formula | C13H19FN2O3 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)NCC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C13H19FN2O3/c1-9(13(18)15-2)16-7-11(17)8-19-12-5-3-10(14)4-6-12/h3-6,9,11,16-17H,7-8H2,1-2H3,(H,15,18) |
| InChIKey | UPAZHAPCJRKFAI-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |