C12H18FNO3 — CID 60909045
1-(4-fluorophenoxy)-3-(1-hydroxypropan-2-ylamino)propan-2-ol (PubChem CID 60909045) has the molecular formula C12H18FNO3 and a molecular weight of 243.28 g/mol. Its IUPAC name is 1-(4-fluorophenoxy)-3-(1-hydroxypropan-2-ylamino)propan-2-ol.
| Compound Name | 1-(4-fluorophenoxy)-3-(1-hydroxypropan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 60909045 |
| Molecular Formula | C12H18FNO3 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 1-(4-fluorophenoxy)-3-(1-hydroxypropan-2-ylamino)propan-2-ol |
| SMILES | CC(CO)NCC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C12H18FNO3/c1-9(7-15)14-6-11(16)8-17-12-4-2-10(13)3-5-12/h2-5,9,11,14-16H,6-8H2,1H3 |
| InChIKey | KSATXFFLJZUZPJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |