C18H18F2N2O2 — CID 110028593
3-fluoro-4-[1-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]ethyl]benzonitrile (PubChem CID 110028593) has the molecular formula C18H18F2N2O2 and a molecular weight of 332.35 g/mol. Its IUPAC name is 3-fluoro-4-[1-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]ethyl]benzonitrile.
| Compound Name | 3-fluoro-4-[1-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 110028593 |
| Molecular Formula | C18H18F2N2O2 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-fluoro-4-[1-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]ethyl]benzonitrile |
| SMILES | CC(NCC(O)COc1ccc(F)cc1)c1ccc(C#N)cc1F |
| InChI | InChI=1S/C18H18F2N2O2/c1-12(17-7-2-13(9-21)8-18(17)20)22-10-15(23)11-24-16-5-3-14(19)4-6-16/h2-8,12,15,22-23H,10-11H2,1H3 |
| InChIKey | JZYYAPVBUBXWJH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |