C20H31FO6S — CID 129387928
(8R,12S)-13-(4-fluorophenoxy)-12-hydroxy-8-methylsulfonyltridecanoic acid (PubChem CID 129387928) has the molecular formula C20H31FO6S and a molecular weight of 418.53 g/mol. Its IUPAC name is (8R,12S)-13-(4-fluorophenoxy)-12-hydroxy-8-methylsulfonyltridecanoic acid.
| Compound Name | (8R,12S)-13-(4-fluorophenoxy)-12-hydroxy-8-methylsulfonyltridecanoic acid |
|---|---|
| PubChem CID | 129387928 |
| Molecular Formula | C20H31FO6S |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (8R,12S)-13-(4-fluorophenoxy)-12-hydroxy-8-methylsulfonyltridecanoic acid |
| SMILES | CS(=O)(=O)[C@H](CCCCCCC(=O)O)CCC[C@H](O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C20H31FO6S/c1-28(25,26)19(8-4-2-3-5-10-20(23)24)9-6-7-17(22)15-27-18-13-11-16(21)12-14-18/h11-14,17,19,22H,2-10,15H2,1H3,(H,23,24)/t17-,19+/m0/s1 |
| InChIKey | BLULZTBNCMRZRI-PKOBYXMFSA-N |
| XLogP | 3.57 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|