C23H34O6 — CID 22759273
8-acetyl-13-(3-acetylphenoxy)-12-hydroxytridecanoic acid (PubChem CID 22759273) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is 8-acetyl-13-(3-acetylphenoxy)-12-hydroxytridecanoic acid.
| Compound Name | 8-acetyl-13-(3-acetylphenoxy)-12-hydroxytridecanoic acid |
|---|---|
| PubChem CID | 22759273 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 8-acetyl-13-(3-acetylphenoxy)-12-hydroxytridecanoic acid |
| SMILES | CC(=O)c1cccc(OCC(O)CCCC(CCCCCCC(=O)O)C(C)=O)c1 |
| InChI | InChI=1S/C23H34O6/c1-17(24)19(9-5-3-4-6-14-23(27)28)10-7-12-21(26)16-29-22-13-8-11-20(15-22)18(2)25/h8,11,13,15,19,21,26H,3-7,9-10,12,14,16H2,1-2H3,(H,27,28) |
| InChIKey | IECJLGHJJODDQO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|