C24H38O7S — CID 22759213
ethyl 8-acetyl-12-hydroxy-13-(3-methylsulfonylphenoxy)tridecanoate (PubChem CID 22759213) has the molecular formula C24H38O7S and a molecular weight of 470.63 g/mol. Its IUPAC name is ethyl 8-acetyl-12-hydroxy-13-(3-methylsulfonylphenoxy)tridecanoate.
| Compound Name | ethyl 8-acetyl-12-hydroxy-13-(3-methylsulfonylphenoxy)tridecanoate |
|---|---|
| PubChem CID | 22759213 |
| Molecular Formula | C24H38O7S |
| Molecular Weight | 470.63 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | ethyl 8-acetyl-12-hydroxy-13-(3-methylsulfonylphenoxy)tridecanoate |
| SMILES | CCOC(=O)CCCCCCC(CCCC(O)COc1cccc(S(C)(=O)=O)c1)C(C)=O |
| InChI | InChI=1S/C24H38O7S/c1-4-30-24(27)16-8-6-5-7-11-20(19(2)25)12-9-13-21(26)18-31-22-14-10-15-23(17-22)32(3,28)29/h10,14-15,17,20-21,26H,4-9,11-13,16,18H2,1-3H3 |
| InChIKey | JNYYHDNIGVRZEJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|