C21H31FO5 — CID 22759250
8-acetyl-13-(2-fluorophenoxy)-12-hydroxytridecanoic acid (PubChem CID 22759250) has the molecular formula C21H31FO5 and a molecular weight of 382.47 g/mol. Its IUPAC name is 8-acetyl-13-(2-fluorophenoxy)-12-hydroxytridecanoic acid.
| Compound Name | 8-acetyl-13-(2-fluorophenoxy)-12-hydroxytridecanoic acid |
|---|---|
| PubChem CID | 22759250 |
| Molecular Formula | C21H31FO5 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 8-acetyl-13-(2-fluorophenoxy)-12-hydroxytridecanoic acid |
| SMILES | CC(=O)C(CCCCCCC(=O)O)CCCC(O)COc1ccccc1F |
| InChI | InChI=1S/C21H31FO5/c1-16(23)17(9-4-2-3-5-14-21(25)26)10-8-11-18(24)15-27-20-13-7-6-12-19(20)22/h6-7,12-13,17-18,24H,2-5,8-11,14-15H2,1H3,(H,25,26) |
| InChIKey | BDSMKFBDYRNRNQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|