C21H26Cl2O5 — CID 22759282
8-acetyl-13-(2,4-dichlorophenoxy)-12-hydroxytridec-5-ynoic acid (PubChem CID 22759282) has the molecular formula C21H26Cl2O5 and a molecular weight of 429.34 g/mol. Its IUPAC name is 8-acetyl-13-(2,4-dichlorophenoxy)-12-hydroxytridec-5-ynoic acid.
| Compound Name | 8-acetyl-13-(2,4-dichlorophenoxy)-12-hydroxytridec-5-ynoic acid |
|---|---|
| PubChem CID | 22759282 |
| Molecular Formula | C21H26Cl2O5 |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 8-acetyl-13-(2,4-dichlorophenoxy)-12-hydroxytridec-5-ynoic acid |
| SMILES | CC(=O)C(CC#CCCCC(=O)O)CCCC(O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H26Cl2O5/c1-15(24)16(7-4-2-3-5-10-21(26)27)8-6-9-18(25)14-28-20-12-11-17(22)13-19(20)23/h11-13,16,18,25H,3,5-10,14H2,1H3,(H,26,27) |
| InChIKey | MZVUTCKFOGWLGZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|