C23H35IO5 — CID 22759222
ethyl 8-acetyl-12-hydroxy-13-(3-iodophenoxy)tridecanoate (PubChem CID 22759222) has the molecular formula C23H35IO5 and a molecular weight of 518.43 g/mol. Its IUPAC name is ethyl 8-acetyl-12-hydroxy-13-(3-iodophenoxy)tridecanoate.
| Compound Name | ethyl 8-acetyl-12-hydroxy-13-(3-iodophenoxy)tridecanoate |
|---|---|
| PubChem CID | 22759222 |
| Molecular Formula | C23H35IO5 |
| Molecular Weight | 518.43 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | ethyl 8-acetyl-12-hydroxy-13-(3-iodophenoxy)tridecanoate |
| SMILES | CCOC(=O)CCCCCCC(CCCC(O)COc1cccc(I)c1)C(C)=O |
| InChI | InChI=1S/C23H35IO5/c1-3-28-23(27)15-7-5-4-6-10-19(18(2)25)11-8-13-21(26)17-29-22-14-9-12-20(24)16-22/h9,12,14,16,19,21,26H,3-8,10-11,13,15,17H2,1-2H3 |
| InChIKey | GHZXBYFIZJNKQO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|