C17H24O5 — CID 71426842
[(2S)-6-(3-formylphenoxy)-2-hydroxyhexyl] butanoate (PubChem CID 71426842) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is [(2S)-6-(3-formylphenoxy)-2-hydroxyhexyl] butanoate.
| Compound Name | [(2S)-6-(3-formylphenoxy)-2-hydroxyhexyl] butanoate |
|---|---|
| PubChem CID | 71426842 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [(2S)-6-(3-formylphenoxy)-2-hydroxyhexyl] butanoate |
| SMILES | CCCC(=O)OC[C@@H](O)CCCCOc1cccc(C=O)c1 |
| InChI | InChI=1S/C17H24O5/c1-2-6-17(20)22-13-15(19)8-3-4-10-21-16-9-5-7-14(11-16)12-18/h5,7,9,11-12,15,19H,2-4,6,8,10,13H2,1H3/t15-/m0/s1 |
| InChIKey | LADAIWCUPXWTRS-HNNXBMFYSA-N |
| XLogP | 2.75 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|