About butanoic acid;3-methoxybenzaldehyde
butanoic acid;3-methoxybenzaldehyde (PubChem CID 143463014) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is butanoic acid;3-methoxybenzaldehyde.
Molecular Properties
| Compound Name | butanoic acid;3-methoxybenzaldehyde |
| PubChem CID | 143463014 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | butanoic acid;3-methoxybenzaldehyde |
| SMILES | CCCC(=O)O.COc1cccc(C=O)c1 |
| InChI | InChI=1S/C8H8O2.C4H8O2/c1-10-8-4-2-3-7(5-8)6-9;1-2-3-4(5)6/h2-6H,1H3;2-3H2,1H3,(H,5,6) |
| InChIKey | CJFGKHXEEQXNSU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze butanoic acid;3-methoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoic acid;3-methoxybenzaldehyde?
The IUPAC name of butanoic acid;3-methoxybenzaldehyde (CID 143463014) is butanoic acid;3-methoxybenzaldehyde.
What is the SMILES notation for butanoic acid;3-methoxybenzaldehyde?
The canonical SMILES for butanoic acid;3-methoxybenzaldehyde is CCCC(=O)O.COc1cccc(C=O)c1.
What is the InChIKey of butanoic acid;3-methoxybenzaldehyde?
The InChIKey is CJFGKHXEEQXNSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C4H8O2/c1-10-8-4-2-3-7(5-8)6-9;1-2-3-4(5)6/h2-6H,1H3;2-3H2,1H3,(H,5,6).
What are the key properties of butanoic acid;3-methoxybenzaldehyde?
butanoic acid;3-methoxybenzaldehyde has a molecular weight of 224.26 g/mol, XLogP of 2.38, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanoic acid;3-methoxybenzaldehyde is sourced from PubChem (CID 143463014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).