C19H26FNO6S — CID 21401588
7-[[5-(4-fluorophenoxy)-4-hydroxypentyl]-methylsulfonylamino]hept-5-ynoic acid (PubChem CID 21401588) has the molecular formula C19H26FNO6S and a molecular weight of 415.48 g/mol. Its IUPAC name is 7-[[5-(4-fluorophenoxy)-4-hydroxypentyl]-methylsulfonylamino]hept-5-ynoic acid.
| Compound Name | 7-[[5-(4-fluorophenoxy)-4-hydroxypentyl]-methylsulfonylamino]hept-5-ynoic acid |
|---|---|
| PubChem CID | 21401588 |
| Molecular Formula | C19H26FNO6S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 7-[[5-(4-fluorophenoxy)-4-hydroxypentyl]-methylsulfonylamino]hept-5-ynoic acid |
| SMILES | CS(=O)(=O)N(CC#CCCCC(=O)O)CCCC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C19H26FNO6S/c1-28(25,26)21(13-5-3-2-4-8-19(23)24)14-6-7-17(22)15-27-18-11-9-16(20)10-12-18/h9-12,17,22H,2,4,6-8,13-15H2,1H3,(H,23,24) |
| InChIKey | YGVDKGGRXDIBKK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|