C26H39NO5 — CID 21038468
methyl 3-[5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate (PubChem CID 21038468) has the molecular formula C26H39NO5 and a molecular weight of 445.60 g/mol. Its IUPAC name is methyl 3-[5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate.
| Compound Name | methyl 3-[5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate |
|---|---|
| PubChem CID | 21038468 |
| Molecular Formula | C26H39NO5 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | methyl 3-[5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate |
| SMILES | CC#CC[C@@H](C)[C@H](O)/C=C/[C@@H]1[C@H]2CC(CCCCC(=O)NCCC(=O)OC)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C26H39NO5/c1-4-5-8-18(2)23(28)12-11-21-22-16-19(15-20(22)17-24(21)29)9-6-7-10-25(30)27-14-13-26(31)32-3/h11-12,15,18,20-24,28-29H,6-10,13-14,16-17H2,1-3H3,(H,27,30)/b12-11+/t18-,20+,21-,22+,23-,24-/m1/s1 |
| InChIKey | QDGQSCFAMWNFHM-TYTJFDQZSA-N |
| XLogP | 3.14 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|