C28H46O5 — CID 10322132
(2E)-2-[(3aS,4R,5R,6aS)-5-(oxan-2-yloxy)-4-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethanol (PubChem CID 10322132) has the molecular formula C28H46O5 and a molecular weight of 462.67 g/mol. Its IUPAC name is (2E)-2-[(3aS,4R,5R,6aS)-5-(oxan-2-yloxy)-4-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethanol.
| Compound Name | (2E)-2-[(3aS,4R,5R,6aS)-5-(oxan-2-yloxy)-4-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethanol |
|---|---|
| PubChem CID | 10322132 |
| Molecular Formula | C28H46O5 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | (2E)-2-[(3aS,4R,5R,6aS)-5-(oxan-2-yloxy)-4-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethanol |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@H]2C/C(=C/CO)C[C@H]2C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C28H46O5/c1-2-3-4-9-23(32-27-10-5-7-16-30-27)12-13-24-25-19-21(14-15-29)18-22(25)20-26(24)33-28-11-6-8-17-31-28/h12-14,22-29H,2-11,15-20H2,1H3/b13-12+,21-14+/t22-,23-,24+,25-,26+,27?,28?/m0/s1 |
| InChIKey | VDRLUFBNKILKMS-VZWQREOQSA-N |
| XLogP | 5.91 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|