C23H36F4O4 — CID 54227241
(3R,3aS,4S,5S,6aR)-3-fluoro-5-methyl-4-[4-methyl-3-(oxan-2-yloxy)-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 54227241) has the molecular formula C23H36F4O4 and a molecular weight of 452.53 g/mol. Its IUPAC name is (3R,3aS,4S,5S,6aR)-3-fluoro-5-methyl-4-[4-methyl-3-(oxan-2-yloxy)-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3R,3aS,4S,5S,6aR)-3-fluoro-5-methyl-4-[4-methyl-3-(oxan-2-yloxy)-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 54227241 |
| Molecular Formula | C23H36F4O4 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | (3R,3aS,4S,5S,6aR)-3-fluoro-5-methyl-4-[4-methyl-3-(oxan-2-yloxy)-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCCC(C)(C(C=C[C@H]1[C@H]2[C@@H](C[C@@H]1C)OC(O)[C@@H]2F)OC1CCCCO1)C(F)(F)F |
| InChI | InChI=1S/C23H36F4O4/c1-4-5-11-22(3,23(25,26)27)17(31-18-8-6-7-12-29-18)10-9-15-14(2)13-16-19(15)20(24)21(28)30-16/h9-10,14-21,28H,4-8,11-13H2,1-3H3/t14-,15+,16+,17?,18?,19-,20+,21?,22?/m0/s1 |
| InChIKey | QGSHEESEZCSGEU-QROFOXROSA-N |
| XLogP | 5.54 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|