C20H32F2O4 — CID 70434470
(3R,3aR,4R)-3-fluoro-4-[(E)-4-fluoro-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 70434470) has the molecular formula C20H32F2O4 and a molecular weight of 374.47 g/mol. Its IUPAC name is (3R,3aR,4R)-3-fluoro-4-[(E)-4-fluoro-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3R,3aR,4R)-3-fluoro-4-[(E)-4-fluoro-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 70434470 |
| Molecular Formula | C20H32F2O4 |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (3R,3aR,4R)-3-fluoro-4-[(E)-4-fluoro-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCCC(F)C(/C=C/[C@H]1CCC2OC(O)[C@H](F)[C@@H]21)OC1CCCCO1 |
| InChI | InChI=1S/C20H32F2O4/c1-2-3-6-14(21)15(25-17-7-4-5-12-24-17)10-8-13-9-11-16-18(13)19(22)20(23)26-16/h8,10,13-20,23H,2-7,9,11-12H2,1H3/b10-8+/t13-,14?,15?,16?,17?,18+,19+,20?/m0/s1 |
| InChIKey | NRJUQTZZKYLYFR-CHYHAAHUSA-N |
| XLogP | 4.06 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|