C32H52FIO7 — CID 70489341
methyl 5-[(3aR,4R,5R,6aS)-3-fluoro-4-[(E,3R)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate (PubChem CID 70489341) has the molecular formula C32H52FIO7 and a molecular weight of 694.66 g/mol. Its IUPAC name is methyl 5-[(3aR,4R,5R,6aS)-3-fluoro-4-[(E,3R)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate.
| Compound Name | methyl 5-[(3aR,4R,5R,6aS)-3-fluoro-4-[(E,3R)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate |
|---|---|
| PubChem CID | 70489341 |
| Molecular Formula | C32H52FIO7 |
| Molecular Weight | 694.66 g/mol |
| Exact Mass | 694.27 |
| IUPAC Name | methyl 5-[(3aR,4R,5R,6aS)-3-fluoro-4-[(E,3R)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate |
| SMILES | CCCCC(C)[C@H](/C=C/[C@@H]1[C@H]2C(F)C(C(I)CCCC(=O)OC)O[C@H]2C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C32H52FIO7/c1-4-5-11-21(2)24(39-28-14-6-8-18-37-28)17-16-22-25(40-29-15-7-9-19-38-29)20-26-30(22)31(33)32(41-26)23(34)12-10-13-27(35)36-3/h16-17,21-26,28-32H,4-15,18-20H2,1-3H3/b17-16+/t21?,22-,23?,24-,25+,26-,28?,29?,30+,31?,32?/m0/s1 |
| InChIKey | LVBFSTZVNLGCPC-DWPDLGPOSA-N |
| XLogP | 7.08 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.66 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|