C15H28O2 — CID 139643960
2-(4,4-dimethyloct-1-en-3-yloxy)oxane (PubChem CID 139643960) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-(4,4-dimethyloct-1-en-3-yloxy)oxane.
| Compound Name | 2-(4,4-dimethyloct-1-en-3-yloxy)oxane |
|---|---|
| PubChem CID | 139643960 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 2-(4,4-dimethyloct-1-en-3-yloxy)oxane |
| SMILES | C=CC(OC1CCCCO1)C(C)(C)CCCC |
| InChI | InChI=1S/C15H28O2/c1-5-7-11-15(3,4)13(6-2)17-14-10-8-9-12-16-14/h6,13-14H,2,5,7-12H2,1,3-4H3 |
| InChIKey | SFWYEESJTGNHHZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|