C25H42O5 — CID 54545277
3-[8-[4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]propanal (PubChem CID 54545277) has the molecular formula C25H42O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is 3-[8-[4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]propanal.
| Compound Name | 3-[8-[4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]propanal |
|---|---|
| PubChem CID | 54545277 |
| Molecular Formula | C25H42O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | 3-[8-[4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]propanal |
| SMILES | CCCCC(C)(C)C(C=CC1CCC2(OCCO2)C1CCC=O)OC1CCCCO1 |
| InChI | InChI=1S/C25H42O5/c1-4-5-14-24(2,3)22(30-23-10-6-7-17-27-23)12-11-20-13-15-25(28-18-19-29-25)21(20)9-8-16-26/h11-12,16,20-23H,4-10,13-15,17-19H2,1-3H3 |
| InChIKey | ZGCCIXAXNVBNFS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|